C25H36N2O8 — CID 155136508
2-[2-[8-[(2-prop-2-enoyloxyethoxycarbonylamino)methyl]-4-tricyclo[5.2.1.02,6]decanyl]ethylcarbamoyloxy]ethyl prop-2-enoate (PubChem CID 155136508) has the molecular formula C25H36N2O8 and a molecular weight of 492.57 g/mol. Its IUPAC name is 2-[2-[8-[(2-prop-2-enoyloxyethoxycarbonylamino)methyl]-4-tricyclo[5.2.1.02,6]decanyl]ethylcarbamoyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[8-[(2-prop-2-enoyloxyethoxycarbonylamino)methyl]-4-tricyclo[5.2.1.02,6]decanyl]ethylcarbamoyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 155136508 |
| Molecular Formula | C25H36N2O8 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 2-[2-[8-[(2-prop-2-enoyloxyethoxycarbonylamino)methyl]-4-tricyclo[5.2.1.02,6]decanyl]ethylcarbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)NCCC1CC2C3CC(CNC(=O)OCCOC(=O)C=C)C(C3)C2C1 |
| InChI | InChI=1S/C25H36N2O8/c1-3-22(28)32-7-9-34-24(30)26-6-5-16-11-19-17-13-18(20(14-17)21(19)12-16)15-27-25(31)35-10-8-33-23(29)4-2/h3-4,16-21H,1-2,5-15H2,(H,26,30)(H,27,31) |
| InChIKey | QIPXOJXXUOTPMI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|