C18H26N2O2 — CID 124925910
N-[[(1R,2R,4R,6R,7S,8R)-8-[(prop-2-enoylamino)methyl]-4-tricyclo[5.2.1.02,6]decanyl]methyl]prop-2-enamide (PubChem CID 124925910) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[[(1R,2R,4R,6R,7S,8R)-8-[(prop-2-enoylamino)methyl]-4-tricyclo[5.2.1.02,6]decanyl]methyl]prop-2-enamide.
| Compound Name | N-[[(1R,2R,4R,6R,7S,8R)-8-[(prop-2-enoylamino)methyl]-4-tricyclo[5.2.1.02,6]decanyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 124925910 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-[[(1R,2R,4R,6R,7S,8R)-8-[(prop-2-enoylamino)methyl]-4-tricyclo[5.2.1.02,6]decanyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC[C@H]1C[C@@H]2[C@H](C1)[C@H]1C[C@@H](CNC(=O)C=C)[C@H]2C1 |
| InChI | InChI=1S/C18H26N2O2/c1-3-17(21)19-9-11-5-14-12-7-13(10-20-18(22)4-2)15(8-12)16(14)6-11/h3-4,11-16H,1-2,5-10H2,(H,19,21)(H,20,22)/t11-,12+,13+,14-,15-,16-/m1/s1 |
| InChIKey | DXVBNLBQGUEJQN-HIFUNWJGSA-N |
| XLogP | 1.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|