C20H29NO — CID 98130254
N-[[(1S,2R,4S,5R,6S)-6-tricyclo[3.2.1.02,4]octanyl]methyl]adamantane-1-carboxamide (PubChem CID 98130254) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is N-[[(1S,2R,4S,5R,6S)-6-tricyclo[3.2.1.02,4]octanyl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[(1S,2R,4S,5R,6S)-6-tricyclo[3.2.1.02,4]octanyl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98130254 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | N-[[(1S,2R,4S,5R,6S)-6-tricyclo[3.2.1.02,4]octanyl]methyl]adamantane-1-carboxamide |
| SMILES | O=C(NC[C@H]1C[C@@H]2C[C@@H]1[C@H]1C[C@H]21)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H29NO/c22-19(20-7-11-1-12(8-20)3-13(2-11)9-20)21-10-15-4-14-5-16(15)18-6-17(14)18/h11-18H,1-10H2,(H,21,22)/t11?,12?,13?,14-,15-,16+,17-,18-,20?/m1/s1 |
| InChIKey | JAZKDACWVNPJNO-HHFPPGDQSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |