C17H28N2O2 — CID 75361888
N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]adamantane-1-carboxamide (PubChem CID 75361888) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]adamantane-1-carboxamide.
| Compound Name | N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 75361888 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]adamantane-1-carboxamide |
| SMILES | CNC(=O)C(C)(C)CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H28N2O2/c1-16(2,14(20)18-3)10-19-15(21)17-7-11-4-12(8-17)6-13(5-11)9-17/h11-13H,4-10H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | DHEFEXDFGOSVCP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |