C18H32N2O — CID 134008139
N-[3-(dimethylamino)-2,2-dimethylpropyl]adamantane-1-carboxamide (PubChem CID 134008139) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]adamantane-1-carboxamide.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 134008139 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]adamantane-1-carboxamide |
| SMILES | CN(C)CC(C)(C)CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H32N2O/c1-17(2,12-20(3)4)11-19-16(21)18-8-13-5-14(9-18)7-15(6-13)10-18/h13-15H,5-12H2,1-4H3,(H,19,21) |
| InChIKey | UDUUWFIIQHSNMS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |