C19H27NO3 — CID 111481019
N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]adamantane-1-carboxamide (PubChem CID 111481019) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]adamantane-1-carboxamide.
| Compound Name | N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 111481019 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(C(C)(O)CNC(=O)C23CC4CC(CC(C4)C2)C3)o1 |
| InChI | InChI=1S/C19H27NO3/c1-12-3-4-16(23-12)18(2,22)11-20-17(21)19-8-13-5-14(9-19)7-15(6-13)10-19/h3-4,13-15,22H,5-11H2,1-2H3,(H,20,21) |
| InChIKey | OHHJFRDVYLRCPQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |