C17H29NO2 — CID 111483676
N-(2-hydroxy-2,3-dimethylbutyl)adamantane-1-carboxamide (PubChem CID 111483676) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is N-(2-hydroxy-2,3-dimethylbutyl)adamantane-1-carboxamide.
| Compound Name | N-(2-hydroxy-2,3-dimethylbutyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 111483676 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | N-(2-hydroxy-2,3-dimethylbutyl)adamantane-1-carboxamide |
| SMILES | CC(C)C(C)(O)CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H29NO2/c1-11(2)16(3,20)10-18-15(19)17-7-12-4-13(8-17)6-14(5-12)9-17/h11-14,20H,4-10H2,1-3H3,(H,18,19) |
| InChIKey | KDSWVUXFNIHIOS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |