C19H31N3O3 — CID 18118534
N-[2-[[2-(tert-butylamino)-2-oxoethyl]amino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 18118534) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[2-[[2-(tert-butylamino)-2-oxoethyl]amino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[[2-(tert-butylamino)-2-oxoethyl]amino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 18118534 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-[2-[[2-(tert-butylamino)-2-oxoethyl]amino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H31N3O3/c1-18(2,3)22-16(24)11-20-15(23)10-21-17(25)19-7-12-4-13(8-19)6-14(5-12)9-19/h12-14H,4-11H2,1-3H3,(H,20,23)(H,21,25)(H,22,24) |
| InChIKey | GDCVJXGLCPZXNC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |