C14H23NO3 — CID 96521441
2-ethyl-N-[(2R)-2-hydroxy-2-(5-methylfuran-2-yl)propyl]butanamide (PubChem CID 96521441) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-ethyl-N-[(2R)-2-hydroxy-2-(5-methylfuran-2-yl)propyl]butanamide.
| Compound Name | 2-ethyl-N-[(2R)-2-hydroxy-2-(5-methylfuran-2-yl)propyl]butanamide |
|---|---|
| PubChem CID | 96521441 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-ethyl-N-[(2R)-2-hydroxy-2-(5-methylfuran-2-yl)propyl]butanamide |
| SMILES | CCC(CC)C(=O)NC[C@@](C)(O)c1ccc(C)o1 |
| InChI | InChI=1S/C14H23NO3/c1-5-11(6-2)13(16)15-9-14(4,17)12-8-7-10(3)18-12/h7-8,11,17H,5-6,9H2,1-4H3,(H,15,16)/t14-/m1/s1 |
| InChIKey | XGKHIBUHFKCHDA-CQSZACIVSA-N |
| XLogP | 2.35 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |