C11H17NO4 — CID 111481021
N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-2-methoxyacetamide (PubChem CID 111481021) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-2-methoxyacetamide.
| Compound Name | N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 111481021 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCC(C)(O)c1ccc(C)o1 |
| InChI | InChI=1S/C11H17NO4/c1-8-4-5-9(16-8)11(2,14)7-12-10(13)6-15-3/h4-5,14H,6-7H2,1-3H3,(H,12,13) |
| InChIKey | BTOYNWJGUTZJLY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |