C15H27N3O3 — CID 111503988
1-[2-(dimethylamino)-2-methylpropyl]-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]urea (PubChem CID 111503988) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-methylpropyl]-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]urea.
| Compound Name | 1-[2-(dimethylamino)-2-methylpropyl]-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]urea |
|---|---|
| PubChem CID | 111503988 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 1-[2-(dimethylamino)-2-methylpropyl]-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]urea |
| SMILES | Cc1ccc(C(C)(O)CNC(=O)NCC(C)(C)N(C)C)o1 |
| InChI | InChI=1S/C15H27N3O3/c1-11-7-8-12(21-11)15(4,20)10-17-13(19)16-9-14(2,3)18(5)6/h7-8,20H,9-10H2,1-6H3,(H2,16,17,19) |
| InChIKey | XDUZMCWXQQPKNX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |