C14H17N3O3 — CID 111486871
1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-pyridin-4-ylurea (PubChem CID 111486871) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 111486871 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-pyridin-4-ylurea |
| SMILES | Cc1ccc(C(C)(O)CNC(=O)Nc2ccncc2)o1 |
| InChI | InChI=1S/C14H17N3O3/c1-10-3-4-12(20-10)14(2,19)9-16-13(18)17-11-5-7-15-8-6-11/h3-8,19H,9H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | DZTUPDLUAASOCL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |