C15H15F3N2O3 — CID 111475072
1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-(3,4,5-trifluorophenyl)urea (PubChem CID 111475072) has the molecular formula C15H15F3N2O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 111475072 |
| Molecular Formula | C15H15F3N2O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-(3,4,5-trifluorophenyl)urea |
| SMILES | Cc1ccc(C(C)(O)CNC(=O)Nc2cc(F)c(F)c(F)c2)o1 |
| InChI | InChI=1S/C15H15F3N2O3/c1-8-3-4-12(23-8)15(2,22)7-19-14(21)20-9-5-10(16)13(18)11(17)6-9/h3-6,22H,7H2,1-2H3,(H2,19,20,21) |
| InChIKey | GLLMWJWAHAQGSB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|