C15H16ClFN2O3 — CID 111474596
1-(2-chloro-5-fluorophenyl)-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]urea (PubChem CID 111474596) has the molecular formula C15H16ClFN2O3 and a molecular weight of 326.76 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]urea.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]urea |
|---|---|
| PubChem CID | 111474596 |
| Molecular Formula | C15H16ClFN2O3 |
| Molecular Weight | 326.76 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-3-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]urea |
| SMILES | Cc1ccc(C(C)(O)CNC(=O)Nc2cc(F)ccc2Cl)o1 |
| InChI | InChI=1S/C15H16ClFN2O3/c1-9-3-6-13(22-9)15(2,21)8-18-14(20)19-12-7-10(17)4-5-11(12)16/h3-7,21H,8H2,1-2H3,(H2,18,19,20) |
| InChIKey | OGLXFSKLMURMHE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.76 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |