C16H18FNO — CID 98122374
4-fluoro-N-[[(1S,2R,4S,5R,6S)-6-tricyclo[3.2.1.02,4]octanyl]methyl]benzamide (PubChem CID 98122374) has the molecular formula C16H18FNO and a molecular weight of 259.32 g/mol. Its IUPAC name is 4-fluoro-N-[[(1S,2R,4S,5R,6S)-6-tricyclo[3.2.1.02,4]octanyl]methyl]benzamide.
| Compound Name | 4-fluoro-N-[[(1S,2R,4S,5R,6S)-6-tricyclo[3.2.1.02,4]octanyl]methyl]benzamide |
|---|---|
| PubChem CID | 98122374 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-fluoro-N-[[(1S,2R,4S,5R,6S)-6-tricyclo[3.2.1.02,4]octanyl]methyl]benzamide |
| SMILES | O=C(NC[C@H]1C[C@@H]2C[C@@H]1[C@H]1C[C@H]21)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FNO/c17-12-3-1-9(2-4-12)16(19)18-8-11-5-10-6-13(11)15-7-14(10)15/h1-4,10-11,13-15H,5-8H2,(H,18,19)/t10-,11-,13+,14-,15-/m1/s1 |
| InChIKey | CEGZNVJNBYIMCF-GBIGGCNCSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |