About 4-fluorobenzohydrazide
4-fluorobenzohydrazide (PubChem CID 9972) has the molecular formula C7H7FN2O
and a molecular weight of 154.14 g/mol. Its IUPAC name is 4-fluorobenzohydrazide.
Molecular Properties
| Compound Name | 4-fluorobenzohydrazide |
| PubChem CID | 9972 |
| Molecular Formula | C7H7FN2O |
| Molecular Weight | 154.14 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 4-fluorobenzohydrazide |
| SMILES | NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C7H7FN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| InChIKey | UIVXXFYJRYVRKJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.14 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzohydrazide?
The IUPAC name of 4-fluorobenzohydrazide (CID 9972) is 4-fluorobenzohydrazide.
What is the SMILES notation for 4-fluorobenzohydrazide?
The canonical SMILES for 4-fluorobenzohydrazide is NNC(=O)c1ccc(F)cc1.
What is the InChIKey of 4-fluorobenzohydrazide?
The InChIKey is UIVXXFYJRYVRKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11).
What are the key properties of 4-fluorobenzohydrazide?
4-fluorobenzohydrazide has a molecular weight of 154.14 g/mol, XLogP of 0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzohydrazide is sourced from PubChem (CID 9972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).