About ethane;4-methylbenzohydrazide
ethane;4-methylbenzohydrazide (PubChem CID 143952809) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is ethane;4-methylbenzohydrazide.
Molecular Properties
| Compound Name | ethane;4-methylbenzohydrazide |
| PubChem CID | 143952809 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | ethane;4-methylbenzohydrazide |
| SMILES | CC.Cc1ccc(C(=O)NN)cc1 |
| InChI | InChI=1S/C8H10N2O.C2H6/c1-6-2-4-7(5-3-6)8(11)10-9;1-2/h2-5H,9H2,1H3,(H,10,11);1-2H3 |
| InChIKey | KVCIBEIOHFWIOT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methylbenzohydrazide?
The IUPAC name of ethane;4-methylbenzohydrazide (CID 143952809) is ethane;4-methylbenzohydrazide.
What is the SMILES notation for ethane;4-methylbenzohydrazide?
The canonical SMILES for ethane;4-methylbenzohydrazide is CC.Cc1ccc(C(=O)NN)cc1.
What is the InChIKey of ethane;4-methylbenzohydrazide?
The InChIKey is KVCIBEIOHFWIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O.C2H6/c1-6-2-4-7(5-3-6)8(11)10-9;1-2/h2-5H,9H2,1H3,(H,10,11);1-2H3.
What are the key properties of ethane;4-methylbenzohydrazide?
ethane;4-methylbenzohydrazide has a molecular weight of 180.25 g/mol, XLogP of 1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methylbenzohydrazide is sourced from PubChem (CID 143952809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).