C23H34N2O8 — CID 129294107
4-[[2-[(2-prop-2-enoyloxyethoxycarbonylamino)methyl]-7-bicyclo[2.2.1]heptanyl]methylcarbamoyloxy]butyl prop-2-enoate (PubChem CID 129294107) has the molecular formula C23H34N2O8 and a molecular weight of 466.53 g/mol. Its IUPAC name is 4-[[2-[(2-prop-2-enoyloxyethoxycarbonylamino)methyl]-7-bicyclo[2.2.1]heptanyl]methylcarbamoyloxy]butyl prop-2-enoate.
| Compound Name | 4-[[2-[(2-prop-2-enoyloxyethoxycarbonylamino)methyl]-7-bicyclo[2.2.1]heptanyl]methylcarbamoyloxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 129294107 |
| Molecular Formula | C23H34N2O8 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 4-[[2-[(2-prop-2-enoyloxyethoxycarbonylamino)methyl]-7-bicyclo[2.2.1]heptanyl]methylcarbamoyloxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)NCC1C2CCC1C(CNC(=O)OCCOC(=O)C=C)C2 |
| InChI | InChI=1S/C23H34N2O8/c1-3-20(26)30-9-5-6-10-32-23(29)25-15-19-16-7-8-18(19)17(13-16)14-24-22(28)33-12-11-31-21(27)4-2/h3-4,16-19H,1-2,5-15H2,(H,24,28)(H,25,29) |
| InChIKey | LBWQMAXLDDCKFN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|