C21H34N2O8 — CID 134238587
4-[[3-[(2-acetyloxyethoxycarbonylamino)methyl]cyclohexyl]methylcarbamoyloxy]butyl prop-2-enoate (PubChem CID 134238587) has the molecular formula C21H34N2O8 and a molecular weight of 442.51 g/mol. Its IUPAC name is 4-[[3-[(2-acetyloxyethoxycarbonylamino)methyl]cyclohexyl]methylcarbamoyloxy]butyl prop-2-enoate.
| Compound Name | 4-[[3-[(2-acetyloxyethoxycarbonylamino)methyl]cyclohexyl]methylcarbamoyloxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 134238587 |
| Molecular Formula | C21H34N2O8 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-[[3-[(2-acetyloxyethoxycarbonylamino)methyl]cyclohexyl]methylcarbamoyloxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)NCC1CCCC(CNC(=O)OCCOC(C)=O)C1 |
| InChI | InChI=1S/C21H34N2O8/c1-3-19(25)29-9-4-5-10-30-20(26)22-14-17-7-6-8-18(13-17)15-23-21(27)31-12-11-28-16(2)24/h3,17-18H,1,4-15H2,2H3,(H,22,26)(H,23,27) |
| InChIKey | STLRYKPMNYKAFL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|