C23H36N2O8 — CID 67679308
3-[[3-[[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]methyl]cyclohexyl]methylcarbamoyloxy]propyl 2-methylprop-2-enoate (PubChem CID 67679308) has the molecular formula C23H36N2O8 and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-[[3-[[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]methyl]cyclohexyl]methylcarbamoyloxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[3-[[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]methyl]cyclohexyl]methylcarbamoyloxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67679308 |
| Molecular Formula | C23H36N2O8 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 3-[[3-[[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]methyl]cyclohexyl]methylcarbamoyloxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOC(=O)NCC1CCCC(CNC(=O)OCCOC(=O)C(=C)C)C1 |
| InChI | InChI=1S/C23H36N2O8/c1-16(2)20(26)30-9-6-10-32-22(28)24-14-18-7-5-8-19(13-18)15-25-23(29)33-12-11-31-21(27)17(3)4/h18-19H,1,3,5-15H2,2,4H3,(H,24,28)(H,25,29) |
| InChIKey | QICGYJSGHKYWQC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|