C19H38N4O4 — CID 118910888
2-(methylamino)ethyl N-[[3-[[2-(tert-butylamino)ethoxycarbonylamino]methyl]cyclohexyl]methyl]carbamate (PubChem CID 118910888) has the molecular formula C19H38N4O4 and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-(methylamino)ethyl N-[[3-[[2-(tert-butylamino)ethoxycarbonylamino]methyl]cyclohexyl]methyl]carbamate.
| Compound Name | 2-(methylamino)ethyl N-[[3-[[2-(tert-butylamino)ethoxycarbonylamino]methyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 118910888 |
| Molecular Formula | C19H38N4O4 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | 2-(methylamino)ethyl N-[[3-[[2-(tert-butylamino)ethoxycarbonylamino]methyl]cyclohexyl]methyl]carbamate |
| SMILES | CNCCOC(=O)NCC1CCCC(CNC(=O)OCCNC(C)(C)C)C1 |
| InChI | InChI=1S/C19H38N4O4/c1-19(2,3)23-9-11-27-18(25)22-14-16-7-5-6-15(12-16)13-21-17(24)26-10-8-20-4/h15-16,20,23H,5-14H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | UCWSUERVJTXTSQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|