C13H16O4 — CID 154536495
(5-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)methyl prop-2-enoate (PubChem CID 154536495) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)methyl prop-2-enoate.
| Compound Name | (5-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 154536495 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (5-oxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CC2CC1C1C(=O)OCC21 |
| InChI | InChI=1S/C13H16O4/c1-2-11(14)16-5-8-3-7-4-9(8)12-10(7)6-17-13(12)15/h2,7-10,12H,1,3-6H2 |
| InChIKey | NVCOGAJWENLUTL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|