C9H13NO2 — CID 146529876
9-amino-4-oxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 146529876) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 9-amino-4-oxatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | 9-amino-4-oxatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 146529876 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 9-amino-4-oxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | NC1CC2CC1C1C(=O)OCC21 |
| InChI | InChI=1S/C9H13NO2/c10-7-2-4-1-5(7)8-6(4)3-12-9(8)11/h4-8H,1-3,10H2 |
| InChIKey | YJLTYUCVPHUSJW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |