C15H20O5 — CID 23594296
(9-ethoxy-3-oxo-4-oxatricyclo[5.2.2.02,6]undecan-8-yl) prop-2-enoate (PubChem CID 23594296) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (9-ethoxy-3-oxo-4-oxatricyclo[5.2.2.02,6]undecan-8-yl) prop-2-enoate.
| Compound Name | (9-ethoxy-3-oxo-4-oxatricyclo[5.2.2.02,6]undecan-8-yl) prop-2-enoate |
|---|---|
| PubChem CID | 23594296 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (9-ethoxy-3-oxo-4-oxatricyclo[5.2.2.02,6]undecan-8-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1C2CCC(C1OCC)C1C(=O)OCC21 |
| InChI | InChI=1S/C15H20O5/c1-3-11(16)20-14-8-5-6-9(13(14)18-4-2)12-10(8)7-19-15(12)17/h3,8-10,12-14H,1,4-7H2,2H3 |
| InChIKey | CZMNAFWVNREWQI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|