C11H16O2 — CID 143708510
(4R,4aR,7S,7aR)-4-ethenyl-7-methyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyran-1-one (PubChem CID 143708510) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (4R,4aR,7S,7aR)-4-ethenyl-7-methyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyran-1-one.
| Compound Name | (4R,4aR,7S,7aR)-4-ethenyl-7-methyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyran-1-one |
|---|---|
| PubChem CID | 143708510 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (4R,4aR,7S,7aR)-4-ethenyl-7-methyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyran-1-one |
| SMILES | C=C[C@H]1COC(=O)[C@H]2[C@@H]1CC[C@@H]2C |
| InChI | InChI=1S/C11H16O2/c1-3-8-6-13-11(12)10-7(2)4-5-9(8)10/h3,7-10H,1,4-6H2,2H3/t7-,8-,9+,10+/m0/s1 |
| InChIKey | XUSPZRBSLGWGAS-AXTSPUMRSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|