About 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate
11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate (PubChem CID 89290617) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate.
Molecular Properties
| Compound Name | 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate |
| PubChem CID | 89290617 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate |
| SMILES | C=CC(=O)OC1C2CCC1C1CCCCC12 |
| InChI | InChI=1S/C14H20O2/c1-2-13(15)16-14-11-7-8-12(14)10-6-4-3-5-9(10)11/h2,9-12,14H,1,3-8H2 |
| InChIKey | KGDMZDSWIQKUCQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate?
The IUPAC name of 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate (CID 89290617) is 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate.
What is the SMILES notation for 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate?
The canonical SMILES for 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate is C=CC(=O)OC1C2CCC1C1CCCCC12.
What is the InChIKey of 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate?
The InChIKey is KGDMZDSWIQKUCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-2-13(15)16-14-11-7-8-12(14)10-6-4-3-5-9(10)11/h2,9-12,14H,1,3-8H2.
What are the key properties of 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate?
11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate has a molecular weight of 220.31 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-tricyclo[6.2.1.02,7]undecanyl prop-2-enoate is sourced from PubChem (CID 89290617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).