C11H14O2 — CID 11816189
[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl prop-2-enoate (PubChem CID 11816189) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is [(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl prop-2-enoate.
| Compound Name | [(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 11816189 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | [(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C11H14O2/c1-2-11(12)13-7-10-6-8-3-4-9(10)5-8/h2-4,8-10H,1,5-7H2/t8-,9+,10?/m0/s1 |
| InChIKey | IEOVKCGOIXZDRK-QIIDTADFSA-N |
| XLogP | 1.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|