About 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate
2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate (PubChem CID 151716584) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate |
| PubChem CID | 151716584 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate |
| SMILES | COCCC(=O)OCC1CC2C=CC1C2 |
| InChI | InChI=1S/C12H18O3/c1-14-5-4-12(13)15-8-11-7-9-2-3-10(11)6-9/h2-3,9-11H,4-8H2,1H3 |
| InChIKey | RHRONDKQSOENFK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate?
The IUPAC name of 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate (CID 151716584) is 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate.
What is the SMILES notation for 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate?
The canonical SMILES for 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate is COCCC(=O)OCC1CC2C=CC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate?
The InChIKey is RHRONDKQSOENFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-14-5-4-12(13)15-8-11-7-9-2-3-10(11)6-9/h2-3,9-11H,4-8H2,1H3.
What are the key properties of 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate?
2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate has a molecular weight of 210.27 g/mol, XLogP of 1.78, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]hept-5-enylmethyl 3-methoxypropanoate is sourced from PubChem (CID 151716584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).