C21H30O6 — CID 162125941
2-bicyclo[2.2.1]hept-5-enylmethyl ethyl carbonate;2-bicyclo[2.2.1]hept-5-enylmethyl methyl carbonate (PubChem CID 162125941) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethyl ethyl carbonate;2-bicyclo[2.2.1]hept-5-enylmethyl methyl carbonate.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethyl ethyl carbonate;2-bicyclo[2.2.1]hept-5-enylmethyl methyl carbonate |
|---|---|
| PubChem CID | 162125941 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethyl ethyl carbonate;2-bicyclo[2.2.1]hept-5-enylmethyl methyl carbonate |
| SMILES | CCOC(=O)OCC1CC2C=CC1C2.COC(=O)OCC1CC2C=CC1C2 |
| InChI | InChI=1S/C11H16O3.C10H14O3/c1-2-13-11(12)14-7-10-6-8-3-4-9(10)5-8;1-12-10(11)13-6-9-5-7-2-3-8(9)4-7/h3-4,8-10H,2,5-7H2,1H3;2-3,7-9H,4-6H2,1H3 |
| InChIKey | ZIAIRRAPFRDLGO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|