C18H28O5 — CID 11427312
diethyl 2-[4-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-hydroxybutyl]propanedioate (PubChem CID 11427312) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is diethyl 2-[4-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-hydroxybutyl]propanedioate.
| Compound Name | diethyl 2-[4-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-hydroxybutyl]propanedioate |
|---|---|
| PubChem CID | 11427312 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | diethyl 2-[4-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-hydroxybutyl]propanedioate |
| SMILES | CCOC(=O)C(CC(O)CCC1C[C@H]2C=C[C@@H]1C2)C(=O)OCC |
| InChI | InChI=1S/C18H28O5/c1-3-22-17(20)16(18(21)23-4-2)11-15(19)8-7-14-10-12-5-6-13(14)9-12/h5-6,12-16,19H,3-4,7-11H2,1-2H3/t12-,13+,14?,15?/m0/s1 |
| InChIKey | ZKVOUMFHTGEMGA-ZUJMUWTESA-N |
| XLogP | 2.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|