C15H24N2O2 — CID 98108430
ethyl 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazine-1-carboxylate (PubChem CID 98108430) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is ethyl 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 98108430 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | ethyl 4-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C[C@@H]2C[C@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C15H24N2O2/c1-2-19-15(18)17-7-5-16(6-8-17)11-14-10-12-3-4-13(14)9-12/h3-4,12-14H,2,5-11H2,1H3/t12-,13-,14-/m0/s1 |
| InChIKey | JUJFEVRIUSAAGS-IHRRRGAJSA-N |
| XLogP | 1.97 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|