C17H26N2O2 — CID 129393526
[4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 129393526) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is [4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 129393526 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | [4-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCO1)N1CCN(C[C@H]2C[C@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C17H26N2O2/c20-17(16-2-1-9-21-16)19-7-5-18(6-8-19)12-15-11-13-3-4-14(15)10-13/h3-4,13-16H,1-2,5-12H2/t13-,14-,15+,16-/m0/s1 |
| InChIKey | PQYNXQXQGUJXAK-JONQDZQNSA-N |
| XLogP | 1.52 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|