C16H22O3 — CID 139891328
ethyl 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl carbonate (PubChem CID 139891328) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethyl 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl carbonate.
| Compound Name | ethyl 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl carbonate |
|---|---|
| PubChem CID | 139891328 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | ethyl 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl carbonate |
| SMILES | CCOC(=O)OCC1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C16H22O3/c1-2-18-16(17)19-8-12-6-11-7-13(12)15-10-4-3-9(5-10)14(11)15/h3-4,9-15H,2,5-8H2,1H3 |
| InChIKey | TVYGWENBYHTEFP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|