C23H36O3 — CID 23517409
(5-hydroxy-5-methylheptyl) 3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propanoate (PubChem CID 23517409) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (5-hydroxy-5-methylheptyl) 3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propanoate.
| Compound Name | (5-hydroxy-5-methylheptyl) 3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propanoate |
|---|---|
| PubChem CID | 23517409 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (5-hydroxy-5-methylheptyl) 3-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propanoate |
| SMILES | CCC(C)(O)CCCCOC(=O)CCC1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C23H36O3/c1-3-23(2,25)10-4-5-11-26-20(24)9-8-15-12-18-14-19(15)22-17-7-6-16(13-17)21(18)22/h6-7,15-19,21-22,25H,3-5,8-14H2,1-2H3 |
| InChIKey | CEIGBHFWEMAXKB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|