C15H20O3 — CID 139891347
methyl 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl carbonate (PubChem CID 139891347) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is methyl 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl carbonate.
| Compound Name | methyl 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl carbonate |
|---|---|
| PubChem CID | 139891347 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | methyl 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl carbonate |
| SMILES | COC(=O)OCC1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C15H20O3/c1-17-15(16)18-7-11-5-10-6-12(11)14-9-3-2-8(4-9)13(10)14/h2-3,8-14H,4-7H2,1H3 |
| InChIKey | MTQKQIUDQXZRRJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|