C19H30O2 — CID 139891389
9-(1-butoxyethoxymethyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 139891389) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 9-(1-butoxyethoxymethyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | 9-(1-butoxyethoxymethyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 139891389 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 9-(1-butoxyethoxymethyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | CCCCOC(C)OCC1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C19H30O2/c1-3-4-7-20-12(2)21-11-16-9-15-10-17(16)19-14-6-5-13(8-14)18(15)19/h5-6,12-19H,3-4,7-11H2,1-2H3 |
| InChIKey | LPNVWQGGXGYQIB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|