C13H17O3P-2 — CID 21125075
4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl phosphite (PubChem CID 21125075) has the molecular formula C13H17O3P-2 and a molecular weight of 252.25 g/mol. Its IUPAC name is 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl phosphite.
| Compound Name | 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl phosphite |
|---|---|
| PubChem CID | 21125075 |
| Molecular Formula | C13H17O3P-2 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enylmethyl phosphite |
| SMILES | [O-]P([O-])OCC1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C13H17O3P/c14-17(15)16-6-10-4-9-5-11(10)13-8-2-1-7(3-8)12(9)13/h1-2,7-13H,3-6H2/q-2 |
| InChIKey | LPHRWWZILINHJY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|