C15H20O — CID 12061826
1-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propan-2-one (PubChem CID 12061826) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propan-2-one.
| Compound Name | 1-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propan-2-one |
|---|---|
| PubChem CID | 12061826 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propan-2-one |
| SMILES | CC(=O)CC1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C15H20O/c1-8(16)4-11-6-12-7-13(11)15-10-3-2-9(5-10)14(12)15/h2-3,9-15H,4-7H2,1H3 |
| InChIKey | DGWIIZPVMJFPDK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|