C16H18O2 — CID 98571872
[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl 2-phenylacetate (PubChem CID 98571872) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl 2-phenylacetate.
| Compound Name | [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 98571872 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)OC[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H18O2/c17-16(10-12-4-2-1-3-5-12)18-11-15-9-13-6-7-14(15)8-13/h1-7,13-15H,8-11H2/t13-,14-,15+/m0/s1 |
| InChIKey | MYZMQJUPBPHYEW-SOUVJXGZSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|