C55H94O8 — CID 59798465
[4-(2-methylprop-2-enoyloxy)cyclohexyl] 8-[4-hexyl-3-octyl-2-[8-oxo-8-(4-prop-2-enoyloxycyclohexyl)oxyoctyl]cyclohexyl]octanoate (PubChem CID 59798465) has the molecular formula C55H94O8 and a molecular weight of 883.35 g/mol. Its IUPAC name is [4-(2-methylprop-2-enoyloxy)cyclohexyl] 8-[4-hexyl-3-octyl-2-[8-oxo-8-(4-prop-2-enoyloxycyclohexyl)oxyoctyl]cyclohexyl]octanoate.
| Compound Name | [4-(2-methylprop-2-enoyloxy)cyclohexyl] 8-[4-hexyl-3-octyl-2-[8-oxo-8-(4-prop-2-enoyloxycyclohexyl)oxyoctyl]cyclohexyl]octanoate |
|---|---|
| PubChem CID | 59798465 |
| Molecular Formula | C55H94O8 |
| Molecular Weight | 883.35 g/mol |
| Exact Mass | 882.69 |
| IUPAC Name | [4-(2-methylprop-2-enoyloxy)cyclohexyl] 8-[4-hexyl-3-octyl-2-[8-oxo-8-(4-prop-2-enoyloxycyclohexyl)oxyoctyl]cyclohexyl]octanoate |
| SMILES | C=CC(=O)OC1CCC(OC(=O)CCCCCCCC2C(CCCCCCCC(=O)OC3CCC(OC(=O)C(=C)C)CC3)CCC(CCCCCC)C2CCCCCCCC)CC1 |
| InChI | InChI=1S/C55H94O8/c1-6-9-11-13-17-23-29-50-44(27-21-12-10-7-2)33-34-45(28-22-16-14-19-25-31-54(58)62-48-39-41-49(42-40-48)63-55(59)43(4)5)51(50)30-24-18-15-20-26-32-53(57)61-47-37-35-46(36-38-47)60-52(56)8-3/h8,44-51H,3-4,6-7,9-42H2,1-2,5H3 |
| InChIKey | HUACZNILZLWLMG-UHFFFAOYSA-N |
| XLogP | 14.98 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.35 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|