About ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate
ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate (PubChem CID 174977721) has the molecular formula C27H48O5
and a molecular weight of 452.68 g/mol. Its IUPAC name is ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate.
Molecular Properties
| Compound Name | ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate |
| PubChem CID | 174977721 |
| Molecular Formula | C27H48O5 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate |
| SMILES | C=C(C)C(=O)OCC.C=CC(=O)OC(=O)CCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C21H38O3.C6H10O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)24-20(22)4-2;1-4-8-6(7)5(2)3/h4H,2-3,5-19H2,1H3;2,4H2,1,3H3 |
| InChIKey | VTBMLKANZWKHHB-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate?
The IUPAC name of ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate (CID 174977721) is ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate.
What is the SMILES notation for ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate?
The canonical SMILES for ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate is C=C(C)C(=O)OCC.C=CC(=O)OC(=O)CCCCCCCCCCCCCCCCC.
What is the InChIKey of ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate?
The InChIKey is VTBMLKANZWKHHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O3.C6H10O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)24-20(22)4-2;1-4-8-6(7)5(2)3/h4H,2-3,5-19H2,1H3;2,4H2,1,3H3.
What are the key properties of ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate?
ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate has a molecular weight of 452.68 g/mol, XLogP of 7.63, 19 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylprop-2-enoate;prop-2-enoyl octadecanoate is sourced from PubChem (CID 174977721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).