C28H46O6 — CID 118666735
cyclohexyl 2-methylprop-2-enoate;cyclohexyl prop-2-enoate;hexyl prop-2-enoate (PubChem CID 118666735) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is cyclohexyl 2-methylprop-2-enoate;cyclohexyl prop-2-enoate;hexyl prop-2-enoate.
| Compound Name | cyclohexyl 2-methylprop-2-enoate;cyclohexyl prop-2-enoate;hexyl prop-2-enoate |
|---|---|
| PubChem CID | 118666735 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | cyclohexyl 2-methylprop-2-enoate;cyclohexyl prop-2-enoate;hexyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCCC1.C=CC(=O)OC1CCCCC1.C=CC(=O)OCCCCCC |
| InChI | InChI=1S/C10H16O2.C9H14O2.C9H16O2/c1-8(2)10(11)12-9-6-4-3-5-7-9;1-2-9(10)11-8-6-4-3-5-7-8;1-3-5-6-7-8-11-9(10)4-2/h9H,1,3-7H2,2H3;2,8H,1,3-7H2;4H,2-3,5-8H2,1H3 |
| InChIKey | AHNGCTHHKAJEDS-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|