C20H30F6O — CID 91518589
1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethyl)propan-2-ol;2-methylpropane (PubChem CID 91518589) has the molecular formula C20H30F6O and a molecular weight of 400.45 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethyl)propan-2-ol;2-methylpropane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethyl)propan-2-ol;2-methylpropane |
|---|---|
| PubChem CID | 91518589 |
| Molecular Formula | C20H30F6O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanylmethyl)propan-2-ol;2-methylpropane |
| SMILES | CC(C)C.OC(CC1CC2CC1C1C3CCC(C3)C21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H20F6O.C4H10/c17-15(18,19)14(23,16(20,21)22)6-10-4-9-5-11(10)13-8-2-1-7(3-8)12(9)13;1-4(2)3/h7-13,23H,1-6H2;4H,1-3H3 |
| InChIKey | IRVSASICDYFXKT-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|