C26H34F12O3 — CID 59071798
1,1,1,3,3,3-hexafluoro-2-[[5-methyl-6-[3-methyl-5-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-ol (PubChem CID 59071798) has the molecular formula C26H34F12O3 and a molecular weight of 622.53 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[5-methyl-6-[3-methyl-5-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[5-methyl-6-[3-methyl-5-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-ol |
|---|---|
| PubChem CID | 59071798 |
| Molecular Formula | C26H34F12O3 |
| Molecular Weight | 622.53 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[5-methyl-6-[3-methyl-5-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-ol |
| SMILES | COCOC(CC1CC2CC1C(C)C2C1C(C)C2CC(CC(O)(C(F)(F)F)C(F)(F)F)C1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H34F12O3/c1-11-13-4-15(8-21(39,23(27,28)29)24(30,31)32)18(6-13)20(11)19-12(2)17-7-14(19)5-16(17)9-22(25(33,34)35,26(36,37)38)41-10-40-3/h11-20,39H,4-10H2,1-3H3 |
| InChIKey | NJHXBCTUZGZFLA-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.53 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|