C22H32F6O3 — CID 20743946
4,5-dimethyl-9-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 20743946) has the molecular formula C22H32F6O3 and a molecular weight of 458.48 g/mol. Its IUPAC name is 4,5-dimethyl-9-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 4,5-dimethyl-9-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 20743946 |
| Molecular Formula | C22H32F6O3 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 4,5-dimethyl-9-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | COCCOCOC(CC1CC2CC1C1C3CC(C(C)C3C)C21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H32F6O3/c1-11-12(2)16-8-15(11)18-13-6-14(17(7-13)19(16)18)9-20(21(23,24)25,22(26,27)28)31-10-30-5-4-29-3/h11-19H,4-10H2,1-3H3 |
| InChIKey | ZOMSSWHWVUGHIZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|