C16H21F9O3 — CID 20743925
2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane (PubChem CID 20743925) has the molecular formula C16H21F9O3 and a molecular weight of 432.32 g/mol. Its IUPAC name is 2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20743925 |
| Molecular Formula | C16H21F9O3 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane |
| SMILES | COCCOCOC(C(F)(F)F)(C(F)(F)F)C1(F)C2CC(C(C)C2C)C1(F)F |
| InChI | InChI=1S/C16H21F9O3/c1-8-9(2)11-6-10(8)12(17,13(11,18)19)14(15(20,21)22,16(23,24)25)28-7-27-5-4-26-3/h8-11H,4-7H2,1-3H3 |
| InChIKey | ALSTYFFOAGLIPH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|