C23H38F6O3 — CID 91081182
tert-butyl 2,2-dimethylbutanoate;2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 91081182) has the molecular formula C23H38F6O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is tert-butyl 2,2-dimethylbutanoate;2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | tert-butyl 2,2-dimethylbutanoate;2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 91081182 |
| Molecular Formula | C23H38F6O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | tert-butyl 2,2-dimethylbutanoate;2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC1C2CC(CC(O)(C(F)(F)F)C(F)(F)F)C(C2)C1C.CCC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H18F6O.C10H20O2/c1-6-7(2)10-4-8(6)3-9(10)5-11(20,12(14,15)16)13(17,18)19;1-7-10(5,6)8(11)12-9(2,3)4/h6-10,20H,3-5H2,1-2H3;7H2,1-6H3 |
| InChIKey | WDYVHTUEOATQJX-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |