C27H42F6O5 — CID 90861152
2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;4-(1-ethylcyclohexyl)oxy-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 90861152) has the molecular formula C27H42F6O5 and a molecular weight of 560.62 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;4-(1-ethylcyclohexyl)oxy-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;4-(1-ethylcyclohexyl)oxy-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90861152 |
| Molecular Formula | C27H42F6O5 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;4-(1-ethylcyclohexyl)oxy-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC1C2CC(CC(O)(C(F)(F)F)C(F)(F)F)C(C2)C1C.CCC1(OC(=O)C(C)C(C)C(=O)O)CCCCC1 |
| InChI | InChI=1S/C14H24O4.C13H18F6O/c1-4-14(8-6-5-7-9-14)18-13(17)11(3)10(2)12(15)16;1-6-7(2)10-4-8(6)3-9(10)5-11(20,12(14,15)16)13(17,18)19/h10-11H,4-9H2,1-3H3,(H,15,16);6-10,20H,3-5H2,1-2H3 |
| InChIKey | HPZMBQKEWROLOZ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |