C13H19F6OP — CID 22887496
[2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyphosphane (PubChem CID 22887496) has the molecular formula C13H19F6OP and a molecular weight of 336.26 g/mol. Its IUPAC name is [2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyphosphane.
| Compound Name | [2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyphosphane |
|---|---|
| PubChem CID | 22887496 |
| Molecular Formula | C13H19F6OP |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [2-[(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyphosphane |
| SMILES | CC1C2CC(CC(OP)(C(F)(F)F)C(F)(F)F)C(C2)C1C |
| InChI | InChI=1S/C13H19F6OP/c1-6-7(2)10-4-8(6)3-9(10)5-11(20-21,12(14,15)16)13(17,18)19/h6-10H,3-5,21H2,1-2H3 |
| InChIKey | RGYQMCFFANHXNK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|