C28H42F6O2 — CID 20771666
9-[2-[1-(2-cyclohexylethoxy)ethoxy]-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 20771666) has the molecular formula C28H42F6O2 and a molecular weight of 524.63 g/mol. Its IUPAC name is 9-[2-[1-(2-cyclohexylethoxy)ethoxy]-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 9-[2-[1-(2-cyclohexylethoxy)ethoxy]-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 20771666 |
| Molecular Formula | C28H42F6O2 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | 9-[2-[1-(2-cyclohexylethoxy)ethoxy]-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC(OCCC1CCCCC1)OC(CC1CC2CC1C1C3CC(C(C)C3C)C21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H42F6O2/c1-15-16(2)22-13-21(15)24-19-11-20(23(12-19)25(22)24)14-26(27(29,30)31,28(32,33)34)36-17(3)35-10-9-18-7-5-4-6-8-18/h15-25H,4-14H2,1-3H3 |
| InChIKey | KSXHPWHTHAGHQC-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|